You can not select more than 25 topics
Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.
1092 lines
38 KiB
1092 lines
38 KiB
# Copyright 1999-2024 Gentoo Authors
|
|
# Distributed under the terms of the GNU General Public License v2
|
|
|
|
####################################################################
|
|
#
|
|
# When you add an entry to the top of this file, add your name, the date
|
|
# in the UTC timezone with a format of YYYY-MM-DD, and an explanation of why
|
|
# something is getting masked.
|
|
# Please be extremely careful not to commit atoms that are not valid, as it can
|
|
# cause large-scale breakage, especially if it ends up in the daily snapshot.
|
|
#
|
|
## Example:
|
|
##
|
|
## # Dev E. Loper <developer@gentoo.org> (2019-07-01)
|
|
## # Masking these versions until we can get the
|
|
## # v4l stuff to work properly again
|
|
## =media-video/mplayer-0.90_pre5
|
|
## =media-video/mplayer-0.90_pre5-r1
|
|
#
|
|
# - Best last rites (removal) practices -
|
|
# Include the following info:
|
|
# a) reason for masking
|
|
# b) bug # for the removal (and yes you should have one)
|
|
# c) date of removal (either the date or "in x days")
|
|
#
|
|
## Example:
|
|
##
|
|
## # Dev E. Loper <developer@gentoo.org> (2019-07-01)
|
|
## # Masked for removal in 30 days. Doesn't work
|
|
## # with new libfoo. Upstream dead, gtk-1, smells
|
|
## # funny. (bug #987654)
|
|
## app-misc/some-package
|
|
|
|
#--- END OF EXAMPLES ---
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-05)
|
|
# A library last bumped in 2010. Homepage gone. No revdeps.
|
|
# Removal on 2024-06-04. Bug #909527.
|
|
dev-games/poker-eval
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-05)
|
|
# A library last bumped in 2004. Homepage gone. Carries patches
|
|
# and hacks already. No reverse dependencies.
|
|
# Removal on 2024-06-04. Bug #909581.
|
|
dev-games/hawknl
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-05)
|
|
# Effectively unmaintained. Unpatched vulnerability reported
|
|
# in February. The Python counterpart is even more outdated.
|
|
# Removal on 2024-06-04. Bug #924129.
|
|
dev-python/ovs
|
|
net-misc/openvswitch
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-05)
|
|
# An unmaintained fork of an unmaintained DNS server. All successive
|
|
# homepages are gone. Last commit in 2014. Already carries a lot
|
|
# of patches and hacks.
|
|
# Removal on 2024-06-04. Bug #928942.
|
|
|
|
net-dns/mydns
|
|
# Sam James <sam@gentoo.org> (2024-05-05)
|
|
# Fails to build w/ broken dist tarball (bug #931240).
|
|
=app-crypt/tpm2-tss-4.1.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-04)
|
|
# A really bad quality package with a never-ending stream of unclear
|
|
# test failures, and blocked keywording and stabilization bugs.
|
|
# The bump to the most recent release is blocked by a ton of test
|
|
# regressions. No reverse dependencies left.
|
|
# Removal on 2024-06-03. Bug #931151.
|
|
dev-python/dask
|
|
dev-python/dask-expr
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2024-05-01)
|
|
# Outdated package, now part of dev-perl/Type-Tiny. Removal in 30 days.
|
|
dev-perl/Type-Tie
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-01)
|
|
# Effectively unmaintained. EAPI 6. Keyworded for PowerPC only.
|
|
# Might not work anymore (when I run it, it hangs input to X11 entirely).
|
|
# Removal on 2024-05-31. Bug #930195.
|
|
sys-apps/mouseemu
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-05-01)
|
|
# Unmaintained in Gentoo. Multiple releases behind upstream. No tests.
|
|
# No Python 3.12. No (unconditional) reverse dependencies.
|
|
# Removal on 2024-05-31. Bug #904945.
|
|
dev-python/grpcio
|
|
dev-python/grpcio-testing
|
|
dev-python/grpcio-tools
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-30)
|
|
# NumPy 2 introduces lots of API changes and an ABI change. Masked
|
|
# for testing and getting <dev-python/numpy-2 where necessary.
|
|
>=dev-python/numexpr-2.10
|
|
>=dev-python/numpy-2
|
|
|
|
# Jason Zaman <perfinion@gentoo.org> (2024-04-28)
|
|
# TensorFlow was removed from the tree in feb, Keras applications and
|
|
# preprocessing no longer have any revdeps in the tree. For ML, the
|
|
# recommendation is to install from pip in a venv.
|
|
# Removal in 30 days. Bug #930830
|
|
sci-libs/keras-applications
|
|
sci-libs/keras-preprocessing
|
|
|
|
# Sam James <sam@gentoo.org> (2024-04-28)
|
|
# Masked for testing. Tracker bug: bug #930805.
|
|
>=sys-libs/ncurses-6.5
|
|
|
|
# Jason Zaman <perfinion@gentoo.org> (2024-04-27)
|
|
# Sandboxfs was only experimental in Bazel. It was fully removed in Bazel-7
|
|
# Bazel was removed from gentoo in Feb.
|
|
# Removal in 30 days. Bug #930790
|
|
sys-fs/sandboxfs
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2024-04-27)
|
|
# EAPI=6 package, has issues with implicit function declarations, has
|
|
# issues with incompatible types and more. The only reverse dependency
|
|
# is virtual/skkserv, which has other better candidates.
|
|
# Removal on 2024-05-27, bug #930781
|
|
app-i18n/skkserv
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2024-04-26)
|
|
# Broken and reported as such upstream. EAPI=6.
|
|
# Removal: 2024-05-26. Bug #912842.
|
|
net-misc/ttytter
|
|
|
|
# Maciej Barć <xgqt@gentoo.org> (2024-04-25)
|
|
# Mask "app-emacs/windows" and reverse dependencies.
|
|
# Very old package failing to compile with modern GNU Emacs.
|
|
# Additionally all 3 packages do not have any definitive repository nor VCS.
|
|
# Open bugs: #930655
|
|
# Removal on 2024-05-25.
|
|
app-emacs/basic-toolkit
|
|
app-emacs/buffer-extension
|
|
app-emacs/windows
|
|
|
|
# Matt Turner <mattst88@gentoo.org> (2024-04-25)
|
|
# Masked for testing
|
|
=dev-util/intel_clc-24.1*
|
|
=media-libs/mesa-24.1*
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# No py3.12, no tests, no maintainer. Also no revdeps.
|
|
# Removal on 2024-05-23. Bug #929513.
|
|
dev-python/sphinxcontrib-newsfeed
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Integrated into >=dev-python/pytest-5.0. No revdeps.
|
|
# Removal on 2024-05-23. Bug #929496.
|
|
dev-python/pytest-faulthandler
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Broken with py3.12. Last commit upstream in 2021. No revdeps.
|
|
# Removal on 2024-05-23. Bug #929484.
|
|
dev-python/pyannotate
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# No py3.12, broken. Upstream literally tells people to use a fork
|
|
# "for the time being". No revdeps.
|
|
# Removal on 2024-05-23. Bug #929461.
|
|
dev-python/kafka-python
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained. No py3.12, failing tests. Last upstream activity
|
|
# in 2020, triggered by our previous last rites. No revdeps.
|
|
# Removal on 2024-05-23. Bug #929445.
|
|
dev-python/cgroup-utils
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained Sphinx theme. Last commit in 2021. No revdeps.
|
|
# Removal on 2024-05-23. Bug #929458.
|
|
dev-python/guzzle_sphinx_theme
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained in Gentoo. Lacking tests, py3.12 support, outdated.
|
|
# No revdeps. The alternatives are dev-python/{llfuse,pyfuse3}.
|
|
# Removal on 2024-05-23. Bug #929453.
|
|
dev-python/fuse-python
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained. Last release in 2003. Carries a ton of patches.
|
|
# Removal on 2024-05-23. Bug #928731.
|
|
net-analyzer/tcpstat
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Added in 2005 and not updated since. Homepage and source mirrors
|
|
# are gone. Needs patches to even build.
|
|
# Removal on 2024-05-23. Bug #928594.
|
|
media-video/vstrip
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Obsolete Pidgin plugin. Last supported in 2008, removed from plugin
|
|
# list in 2019.
|
|
# Removal on 2024-05-23. Bug #928578.
|
|
net-im/librvp
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained GTK+2 application. Last update in 2005.
|
|
# Alternatives include media-sound/fmit and media-sound/lingot.
|
|
# Removal on 2024-05-23. Bug #928512.
|
|
media-sound/pitchtune
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Ancient. Homepage gone. There are many alternative network testing
|
|
# tools, such as net-misc/iperf.
|
|
# Removal on 2024-05-23. Bug #928133.
|
|
net-analyzer/gensink
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# An old, unmaintained theme. The last revdep stopped using it.
|
|
# Removal on 2024-05-23. Bug #927764.
|
|
dev-python/sphinx-py3doc-enhanced-theme
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained in Gentoo and seriously outdated. EAPI 6. No revdeps.
|
|
# There seem to be an up-to-date ebuilds in ::mva.
|
|
# Removal on 2024-05-23. Bug #928070.
|
|
dev-util/android-ndk
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Unmaintained in Gentoo and seriously outdated. Its only reverse
|
|
# dependency is app-admin/testdisk, and the current TestDisk versions
|
|
# do not build against this version anyway
|
|
# Removal on 2024-05-23. Bug #927076.
|
|
app-forensics/libewf
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-23)
|
|
# Superseded by dev-python/tinycss2. No revdeps.
|
|
# Removal on 2024-05-23. Bug #930503.
|
|
dev-python/tinycss
|
|
|
|
# Matthew Smith <matthew@gentoo.org> (2024-04-23)
|
|
# Security issues (Bug #920682).
|
|
# See the following link for breaking changes:
|
|
# https://www.erlang.org/patches/otp-26.2#incompatibilities
|
|
# Removal on 2024-05-23
|
|
<dev-lang/elixir-1.14.5-r2
|
|
=dev-lang/elixir-1.15.6
|
|
<dev-lang/erlang-26.2.1
|
|
|
|
# Matthew Smith <matthew@gentoo.org> (2024-04-23)
|
|
# Security issues (Bug #918527) and blocking cleanup of vulnerable
|
|
# dev-lang/erlang versions. Please upgrade.
|
|
# https://www.rabbitmq.com/docs/upgrade
|
|
# Removal on 2024-05-23
|
|
<net-misc/rabbitmq-server-3.13.1
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2024-04-20)
|
|
# EAPI6 package, with no reverse dependencies. Not really maintained
|
|
# since gentoo's transition to git. Distfile is fetch and mirror
|
|
# restricted, and based on comment in ebuild, the source isn't stable
|
|
# and we can lose the only source for distfile.
|
|
# Removal on 2024-05-20, bug #930346.
|
|
sys-block/megamgr
|
|
|
|
# Maciej Barć <xgqt@gentoo.org> (2024-04-20)
|
|
# No reverse dependencies, old packages for mono, uses abandoned mono.eclass.
|
|
# Dotnet Project is not willing to take up those packages.
|
|
# Open bugs: #679440
|
|
# Removal on 2024-05-20
|
|
dev-dotnet/monocalendar
|
|
dev-dotnet/ndesk-dbus
|
|
dev-dotnet/ndesk-dbus-glib
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2024-04-19)
|
|
# EAPI=6, library only without any reverse dependencies, uses
|
|
# deprecated go eclasses, maintainer-needed.
|
|
# Removal on 2024-05-19, bug #930249
|
|
dev-go/qr
|
|
dev-go/twofactor
|
|
|
|
# Andrew Ammerlaan <andrewammerlaan@gentoo.org> (2024-04-18)
|
|
# Upstream gone, unfetchable, stuck on EAPI 6. Bug 605796
|
|
# Removal on 2024-05-18
|
|
sci-visualization/spectromatic
|
|
|
|
# Fabian Groffen <grobian@gentoo.org> (2024-04-16)
|
|
# Official latest Python support 3.8, replacement app-metrics/go-carbon
|
|
# is more performant and designed to be a drop-in replacement.
|
|
# Removal on 2024-05-16, bug #929444
|
|
dev-python/carbon
|
|
|
|
# Fabian Groffen <grobian@gentoo.org> (2024-04-13)
|
|
# Python wrapper around liblmsensors, no reverse dependencies
|
|
# Removal on 2024-05-13, bug #929495
|
|
dev-python/PySensors
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2024-04-12)
|
|
# EAPI6. Fails to compile with go versions in tree. Upstream is archived.
|
|
# Uses deprecated go eclasses. Maintainer needed, no rev deps.
|
|
# Removal: 2024-05-12. Bugs #794913, #679348, #771072, #844607.
|
|
app-emulation/runv
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-04-11)
|
|
# Contains a bug that could render the kernel fail to boot.
|
|
# https://lore.kernel.org/oe-lkp/202403221630.2692c998-oliver.sang@intel.com/
|
|
# The fix is:
|
|
# https://git.kernel.org/pub/scm/linux/kernel/git/torvalds/linux.git/commit/?id=e7d24c0aa8e678f41457d1304e2091cac6fd1a2e
|
|
=sys-kernel/gentoo-kernel-6.6.26
|
|
=sys-kernel/gentoo-kernel-bin-6.6.26
|
|
=sys-kernel/vanilla-kernel-6.6.26
|
|
=sys-kernel/vanilla-kernel-6.8.5
|
|
|
|
# Volkmar W. Pogatzki <gentoo@pogatzki.net> (2024-04-08)
|
|
# Obsolete java-vm, bugs #848804 #830248.
|
|
# Removal on 2024-05-08
|
|
dev-java/icedtea-bin
|
|
|
|
# Volkmar W. Pogatzki <gentoo@pogatzki.net> (2024-04-08)
|
|
# Java libraries without consumers.
|
|
# Removal on 2024-05-08, bugs #853100 #716228.
|
|
dev-java/gin
|
|
dev-java/gwt
|
|
dev-java/validation-api
|
|
|
|
# Ben Kohler <bkohler@gentoo.org> (2024-04-07)
|
|
# Abandoned upstream long ago in favor of Unifi Protect (running only on an
|
|
# official Unifi appliance. Likely contains lots of security holes in bundled
|
|
# libs.
|
|
# Removal on 2024-05-07. Bug #928881
|
|
acct-group/unifi-video
|
|
acct-user/unifi-video
|
|
media-video/unifi-video
|
|
|
|
# Ben Kohler <bkohler@gentoo.org> (2024-04-07)
|
|
# Long ago forked to and obsoleted by sys-apps/memtest86+. Upstream has
|
|
# abandoned this for their proprietary UEFI-based one (packaged in gentoo as
|
|
# as sys-apps/memtest86-bin).
|
|
# Removal on 2024-05-07. Bug #502464, #607494, #628528, #750677, #887003,
|
|
# #912973, #920109
|
|
sys-apps/memtest86
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2024-04-06)
|
|
# Dead upstream for many years, in a state of decay and no revdeps.
|
|
# Removal on 2024-05-06. Bug #926193, #891791
|
|
net-im/telepathy-connection-managers
|
|
net-libs/sofia-sip
|
|
net-libs/telepathy-accounts-signon
|
|
net-libs/telepathy-farstream
|
|
net-libs/telepathy-qt
|
|
net-voip/telepathy-gabble
|
|
net-voip/telepathy-rakia
|
|
net-voip/telepathy-salut
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2024-04-06)
|
|
# Dead upstream, as is the whole telepathy stack. Some parts depend on
|
|
# dev-qt/qtwebengine:5.
|
|
# Removal on 2024-05-06. Bug #926679
|
|
kde-apps/ktp-accounts-kcm
|
|
kde-apps/ktp-approver
|
|
kde-apps/ktp-auth-handler
|
|
kde-apps/ktp-common-internals
|
|
kde-apps/ktp-contact-list
|
|
kde-apps/ktp-contact-runner
|
|
kde-apps/ktp-desktop-applets
|
|
kde-apps/ktp-filetransfer-handler
|
|
kde-apps/ktp-kded-module
|
|
kde-apps/ktp-send-file
|
|
kde-apps/ktp-text-ui
|
|
kde-apps/plasma-telepathy-meta
|
|
net-libs/telepathy-logger-qt
|
|
|
|
# James Le Cuirot <chewi@gentoo.org> (2024-04-05)
|
|
# Dead upstream and broken beyond repair. Removal on 2024-05-05. Bug #928591.
|
|
games-board/xmille
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-03-30)
|
|
# NIH package that was added for dev-python/setuptools but is no longer
|
|
# used there.
|
|
# Removal on 2024-04-29. Bug #928270.
|
|
dev-python/nspektr
|
|
|
|
# James Le Cuirot <chewi@gentoo.org> (2024-03-30)
|
|
# Old, ugly, broken, and requires OSS sound. Removal on 2024-04-30. Bug #928066.
|
|
games-sports/gracer
|
|
|
|
# Sam James <sam@gentoo.org> (2024-03-28)
|
|
# Newer 5.4.x releases were signed by a potentially compromised upstream maintainer.
|
|
# There is no evidence that these releases contain malicious code, but masked
|
|
# out of an abundance of caution. See bug #928134.
|
|
sec-keys/openpgp-keys-jiatan
|
|
~app-arch/xz-utils-5.4.3
|
|
~app-arch/xz-utils-5.4.4
|
|
~app-arch/xz-utils-5.4.5
|
|
~app-arch/xz-utils-5.4.6
|
|
|
|
# Sam James <sam@gentoo.org> (2024-03-28)
|
|
# Backdoor discovered in release tarballs. DOWNGRADE NOW.
|
|
# https://www.openwall.com/lists/oss-security/2024/03/29/4
|
|
# https://bugs.gentoo.org/928134
|
|
~app-arch/xz-utils-5.5.1_alpha
|
|
~app-arch/xz-utils-5.5.2_beta
|
|
~app-arch/xz-utils-5.6.0
|
|
~app-arch/xz-utils-5.6.1
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-03-26)
|
|
# Uses deprecated distutils-r1 API. Depends on dev-qt/qtwebengine:5.
|
|
# Includes the libraries with no other reverse dependencies.
|
|
# Removal on 2024-04-25. Bug #909996.
|
|
media-libs/libopenshot
|
|
media-libs/libopenshot-audio
|
|
media-video/openshot
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2024-03-26)
|
|
# Issues with OpenSSL 3. Unmaintained. Last activity in 2019.
|
|
# Removal on 2024-04-25. Bug #892031.
|
|
sys-auth/pam_ssh
|
|
|
|
# Eray Aslan <eras@gentoo.org> (2024-03-10)
|
|
# Mask experimental software
|
|
=mail-mta/postfix-3.10*
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2024-04-16)
|
|
# KDE Plasma 6.0.4, Gear 24.02.2 and Frameworks 6.1.0 mask
|
|
#
|
|
# Don't do anything unless you're intentionally moving to Plasma 6, which is
|
|
# masked still for a reason. If you get this message just from conflicts where
|
|
# you're not trying to do that, please cleanup stale entries in /etc/portage
|
|
# and your world file.
|
|
#
|
|
# Plasma 6 replaces 5. For conflict resolution between KF5- and KF6-packages:
|
|
# - put '-kf6compat' into /etc/portage/profile/use.mask
|
|
# - enable USE=kf6compat globally
|
|
# - if you have the following packages installed, put the following into
|
|
# /etc/portage/package.use in order to avoid conflicts:
|
|
# dev-util/kdevelop:5 -gdbui -plasma
|
|
# If you encounter ...
|
|
# - build-time/packaging bugs:
|
|
# - file a bug after making sure none exists yet for your issue
|
|
# - runtime bugs: https://community.kde.org/Plasma/Plasma_6#How_to_use/test_it
|
|
# - work with upstream and help test patches using /etc/portage/patches
|
|
~kde-frameworks/frameworkintegration-6.1.0
|
|
~kde-frameworks/attica-6.1.0
|
|
~kde-frameworks/bluez-qt-6.1.0
|
|
~kde-frameworks/breeze-icons-6.1.0
|
|
~kde-frameworks/extra-cmake-modules-6.1.0
|
|
~kde-frameworks/karchive-6.1.0
|
|
~kde-frameworks/kcalendarcore-6.1.0
|
|
~kde-frameworks/kcodecs-6.1.0
|
|
~kde-frameworks/kconfig-6.1.0
|
|
~kde-frameworks/kcoreaddons-6.1.0
|
|
~kde-frameworks/kdbusaddons-6.1.0
|
|
~kde-frameworks/kdnssd-6.1.0
|
|
~kde-frameworks/kguiaddons-6.1.0
|
|
~kde-frameworks/kholidays-6.1.0
|
|
~kde-frameworks/ki18n-6.1.0
|
|
~kde-frameworks/kidletime-6.1.0
|
|
~kde-frameworks/kirigami-6.1.0
|
|
~kde-frameworks/kitemmodels-6.1.0
|
|
~kde-frameworks/kitemviews-6.1.0
|
|
~kde-frameworks/kplotting-6.1.0
|
|
~kde-frameworks/kquickcharts-6.1.0
|
|
~kde-frameworks/ktexttemplate-6.1.0
|
|
~kde-frameworks/kuserfeedback-6.1.0
|
|
~kde-frameworks/kwidgetsaddons-6.1.0
|
|
~kde-frameworks/kwindowsystem-6.1.0
|
|
~kde-frameworks/modemmanager-qt-6.1.0
|
|
~kde-frameworks/networkmanager-qt-6.1.0
|
|
~kde-frameworks/prison-6.1.0
|
|
~kde-frameworks/solid-6.1.1
|
|
~kde-frameworks/sonnet-6.1.0
|
|
~kde-frameworks/syntax-highlighting-6.1.0
|
|
~kde-frameworks/threadweaver-6.1.0
|
|
~kde-frameworks/kauth-6.1.0
|
|
~kde-frameworks/kcolorscheme-6.1.0
|
|
~kde-frameworks/kcompletion-6.1.0
|
|
~kde-frameworks/kcontacts-6.1.0
|
|
~kde-frameworks/kcrash-6.1.0
|
|
~kde-frameworks/kdoctools-6.1.0
|
|
~kde-frameworks/kfilemetadata-6.1.0
|
|
~kde-frameworks/kimageformats-6.1.0
|
|
~kde-frameworks/kjobwidgets-6.1.0
|
|
~kde-frameworks/knotifications-6.1.0
|
|
~kde-frameworks/kpackage-6.1.0
|
|
~kde-frameworks/kpeople-6.1.0
|
|
~kde-frameworks/kpty-6.1.0
|
|
~kde-frameworks/kstatusnotifieritem-6.1.0
|
|
~kde-frameworks/ksvg-6.1.0
|
|
~kde-frameworks/kunitconversion-6.1.0
|
|
~kde-frameworks/syndication-6.1.0
|
|
~kde-frameworks/baloo-6.1.0
|
|
~kde-frameworks/kbookmarks-6.1.0
|
|
~kde-frameworks/kcmutils-6.1.0
|
|
~kde-frameworks/kconfigwidgets-6.1.0
|
|
~kde-frameworks/kdav-6.1.0
|
|
~kde-frameworks/kdeclarative-6.1.0
|
|
~kde-frameworks/kded-6.1.0
|
|
~kde-frameworks/kdesu-6.1.0
|
|
~kde-frameworks/kglobalaccel-6.1.0
|
|
~kde-frameworks/kiconthemes-6.1.0
|
|
~kde-frameworks/kio-6.1.0
|
|
~kde-frameworks/knewstuff-6.1.0
|
|
~kde-frameworks/knotifyconfig-6.1.0
|
|
~kde-frameworks/kparts-6.1.0
|
|
~kde-frameworks/krunner-6.1.0
|
|
~kde-frameworks/kservice-6.1.0
|
|
~kde-frameworks/ktexteditor-6.1.0
|
|
~kde-frameworks/ktextwidgets-6.1.0
|
|
~kde-frameworks/kwallet-6.1.0
|
|
~kde-frameworks/kxmlgui-6.1.0
|
|
~kde-frameworks/purpose-6.1.0
|
|
~kde-frameworks/qqc2-desktop-style-6.1.0
|
|
~kde-plasma/bluedevil-6.0.4
|
|
~kde-plasma/breeze-6.0.4
|
|
~kde-plasma/breeze-grub-6.0.4
|
|
~kde-plasma/breeze-gtk-6.0.4.1
|
|
~kde-plasma/breeze-plymouth-6.0.4.1
|
|
~kde-plasma/discover-6.0.4
|
|
~kde-plasma/drkonqi-6.0.4
|
|
~kde-plasma/flatpak-kcm-6.0.4
|
|
~kde-plasma/kactivitymanagerd-6.0.4
|
|
~kde-plasma/kde-cli-tools-6.0.4
|
|
~kde-plasma/kde-gtk-config-6.0.4
|
|
~kde-plasma/kdecoration-6.0.4
|
|
~kde-plasma/kdeplasma-addons-6.0.4
|
|
~kde-plasma/kgamma-6.0.4
|
|
~kde-plasma/kglobalacceld-6.0.4
|
|
~kde-plasma/kinfocenter-6.0.4
|
|
~kde-plasma/kmenuedit-6.0.4
|
|
~kde-plasma/kpipewire-6.0.4
|
|
~kde-plasma/kscreen-6.0.4
|
|
~kde-plasma/kscreenlocker-6.0.4
|
|
~kde-plasma/ksshaskpass-6.0.4
|
|
~kde-plasma/ksystemstats-6.0.4
|
|
~kde-plasma/kwallet-pam-6.0.4
|
|
~kde-plasma/kwayland-6.0.4
|
|
~kde-plasma/kwayland-integration-6.0.4
|
|
~kde-plasma/kwin-6.0.4.1
|
|
~kde-plasma/kwrited-6.0.4
|
|
~kde-plasma/layer-shell-qt-6.0.4
|
|
~kde-plasma/libkscreen-6.0.4
|
|
~kde-plasma/libksysguard-6.0.4
|
|
~kde-plasma/libplasma-6.0.4
|
|
~kde-plasma/milou-6.0.4
|
|
~kde-plasma/ocean-sound-theme-6.0.4
|
|
~kde-plasma/oxygen-6.0.4
|
|
~kde-plasma/oxygen-sounds-6.0.4
|
|
~kde-plasma/plasma-activities-6.0.4
|
|
~kde-plasma/plasma-activities-stats-6.0.4
|
|
~kde-plasma/plasma-browser-integration-6.0.4
|
|
~kde-plasma/plasma-desktop-6.0.4
|
|
~kde-plasma/plasma-disks-6.0.4
|
|
~kde-plasma/plasma-firewall-6.0.4
|
|
~kde-plasma/plasma-integration-6.0.4
|
|
~kde-plasma/plasma-meta-6.0.4
|
|
~kde-plasma/plasma-nm-6.0.4
|
|
~kde-plasma/plasma-pa-6.0.4
|
|
~kde-plasma/plasma-sdk-6.0.4
|
|
~kde-plasma/plasma-systemmonitor-6.0.4
|
|
~kde-plasma/plasma-thunderbolt-6.0.4
|
|
~kde-plasma/plasma-vault-6.0.4
|
|
~kde-plasma/plasma-welcome-6.0.4
|
|
~kde-plasma/plasma-workspace-6.0.4
|
|
~kde-plasma/plasma-workspace-wallpapers-6.0.4
|
|
~kde-plasma/plasma5support-6.0.4
|
|
~kde-plasma/plymouth-kcm-6.0.4
|
|
~kde-plasma/polkit-kde-agent-6.0.4
|
|
~kde-plasma/powerdevil-6.0.4
|
|
~kde-plasma/print-manager-6.0.4
|
|
~kde-plasma/qqc2-breeze-style-6.0.4
|
|
~kde-plasma/sddm-kcm-6.0.4
|
|
~kde-plasma/systemsettings-6.0.4
|
|
~kde-plasma/wacomtablet-6.0.4
|
|
~kde-plasma/xdg-desktop-portal-kde-6.0.4
|
|
~kde-apps/baloo-widgets-24.02.2
|
|
~kde-apps/dolphin-24.02.2
|
|
~kde-apps/ffmpegthumbs-24.02.2
|
|
~kde-apps/kate-24.02.2
|
|
~kde-apps/kate-addons-24.02.2
|
|
~kde-apps/kate-lib-24.02.2
|
|
~kde-apps/kde-apps-meta-24.02.2
|
|
~kde-apps/kdecore-meta-24.02.2
|
|
~kde-apps/khelpcenter-24.02.2
|
|
~kde-apps/konsole-24.02.2
|
|
~kde-apps/kwrite-24.02.2
|
|
~kde-apps/kdialog-24.02.2
|
|
~kde-apps/keditbookmarks-24.02.2
|
|
~kde-apps/kfind-24.02.2
|
|
~kde-apps/konqueror-24.02.2
|
|
~www-client/falkon-24.02.2
|
|
~app-accessibility/kontrast-24.02.2
|
|
~kde-apps/kdeaccessibility-meta-24.02.2
|
|
~kde-apps/kmag-24.02.2
|
|
~kde-apps/kmousetool-24.02.2
|
|
~kde-apps/kmouth-24.02.2
|
|
~kde-apps/kdeadmin-meta-24.02.2
|
|
~kde-apps/kcron-24.02.2
|
|
~kde-apps/ksystemlog-24.02.2
|
|
~kde-apps/analitza-24.02.2
|
|
~kde-apps/blinken-24.02.2
|
|
~kde-apps/kalgebra-24.02.2
|
|
~kde-apps/kanagram-24.02.2
|
|
~kde-apps/kbruch-24.02.2
|
|
~kde-apps/kdeedu-meta-24.02.2
|
|
~kde-apps/kgeography-24.02.2
|
|
~kde-apps/khangman-24.02.2
|
|
~kde-apps/kiten-24.02.2
|
|
~kde-apps/klettres-24.02.2
|
|
~kde-apps/kturtle-24.02.2
|
|
~kde-apps/kwordquiz-24.02.2
|
|
~kde-apps/libkeduvocdocument-24.02.2
|
|
~kde-apps/parley-24.02.2
|
|
~kde-apps/bomber-24.02.2
|
|
~kde-apps/bovo-24.02.2
|
|
~kde-apps/granatier-24.02.2
|
|
~kde-apps/kajongg-24.02.2
|
|
~kde-apps/kapman-24.02.2
|
|
~kde-apps/katomic-24.02.2
|
|
~kde-apps/kblackbox-24.02.2
|
|
~kde-apps/kblocks-24.02.2
|
|
~kde-apps/kbounce-24.02.2
|
|
~kde-apps/kbreakout-24.02.2
|
|
~kde-apps/kdegames-meta-24.02.2
|
|
~kde-apps/kdiamond-24.02.2
|
|
~kde-apps/kfourinline-24.02.2
|
|
~kde-apps/kgoldrunner-24.02.2
|
|
~kde-apps/kigo-24.02.2
|
|
~kde-apps/killbots-24.02.2
|
|
~kde-apps/kiriki-24.02.2
|
|
~kde-apps/kjumpingcube-24.02.2
|
|
~kde-apps/klickety-24.02.2
|
|
~kde-apps/klines-24.02.2
|
|
~kde-apps/kmahjongg-24.02.2
|
|
~kde-apps/kmines-24.02.2
|
|
~kde-apps/knavalbattle-24.02.2
|
|
~kde-apps/knetwalk-24.02.2
|
|
~kde-apps/knights-24.02.2
|
|
~kde-apps/kolf-24.02.2
|
|
~kde-apps/kollision-24.02.2
|
|
~kde-apps/konquest-24.02.2
|
|
~kde-apps/kpat-24.02.2
|
|
~kde-apps/kreversi-24.02.2
|
|
~kde-apps/kshisen-24.02.2
|
|
~kde-apps/ksirk-24.02.2
|
|
~kde-apps/ksnakeduel-24.02.2
|
|
~kde-apps/kspaceduel-24.02.2
|
|
~kde-apps/ksquares-24.02.2
|
|
~kde-apps/ksudoku-24.02.2
|
|
~kde-apps/ktuberling-24.02.2
|
|
~kde-apps/kubrick-24.02.2
|
|
~kde-apps/libkdegames-24.02.2
|
|
~kde-apps/libkmahjongg-24.02.2
|
|
~kde-apps/lskat-24.02.2
|
|
~kde-apps/palapeli-24.02.2
|
|
~kde-apps/picmi-24.02.2
|
|
~kde-apps/gwenview-24.02.2
|
|
~kde-apps/kamera-24.02.2
|
|
~kde-apps/kcolorchooser-24.02.2
|
|
~kde-apps/kdegraphics-meta-24.02.2
|
|
~kde-apps/kdegraphics-mobipocket-24.02.2
|
|
~kde-apps/kruler-24.02.2
|
|
~kde-apps/libkdcraw-24.02.2
|
|
~kde-apps/libkexiv2-24.02.2
|
|
~kde-apps/okular-24.02.2
|
|
~kde-apps/spectacle-24.02.2
|
|
~kde-apps/svgpart-24.02.2
|
|
~kde-apps/thumbnailers-24.02.2
|
|
~kde-misc/colord-kde-24.02.2
|
|
~media-gfx/skanpage-24.02.2
|
|
~media-libs/ksanecore-24.02.2
|
|
~kde-apps/audiocd-kio-24.02.2
|
|
~kde-apps/dragon-24.02.2
|
|
~kde-apps/juk-24.02.2
|
|
~kde-apps/kdemultimedia-meta-24.02.2
|
|
~kde-apps/kdenlive-24.02.2
|
|
~kde-apps/libkcddb-24.02.2
|
|
~kde-apps/libkcompactdisc-24.02.2
|
|
~media-sound/elisa-24.02.2
|
|
~media-sound/kasts-24.02.2
|
|
~media-sound/krecorder-24.02.2
|
|
~kde-apps/dolphin-plugins-dropbox-24.02.2
|
|
~kde-apps/kaccounts-integration-24.02.2
|
|
~kde-apps/kaccounts-providers-24.02.2
|
|
~kde-apps/kdenetwork-meta-24.02.2
|
|
~kde-apps/kdenetwork-filesharing-24.02.2
|
|
~kde-apps/kget-24.02.2
|
|
~kde-apps/kio-extras-24.02.2
|
|
~kde-apps/krfb-24.02.2
|
|
~kde-apps/signon-kwallet-extension-24.02.2
|
|
~kde-misc/kdeconnect-24.02.2
|
|
~kde-misc/kio-gdrive-24.02.2
|
|
~net-im/neochat-24.02.2
|
|
~net-im/tokodon-24.02.2
|
|
~net-irc/konversation-24.02.2
|
|
~net-libs/libktorrent-24.02.2
|
|
~net-misc/kio-zeroconf-24.02.2
|
|
~net-news/alligator-24.02.2
|
|
~net-p2p/ktorrent-24.02.2
|
|
~app-office/merkuro-24.02.2
|
|
~dev-libs/kopeninghours-24.02.2
|
|
~dev-libs/kosmindoormap-24.02.2
|
|
~dev-libs/kpublictransport-24.02.2
|
|
~kde-apps/akonadi-24.02.2
|
|
~kde-apps/akonadi-calendar-24.02.2
|
|
~kde-apps/akonadi-contacts-24.02.2
|
|
~kde-apps/akonadi-import-wizard-24.02.2
|
|
~kde-apps/akonadi-mime-24.02.2
|
|
~kde-apps/akonadi-notes-24.02.2
|
|
~kde-apps/akonadi-search-24.02.2
|
|
~kde-apps/akonadiconsole-24.02.2
|
|
~kde-apps/akregator-24.02.2
|
|
~kde-apps/calendarjanitor-24.02.2
|
|
~kde-apps/calendarsupport-24.02.2
|
|
~kde-apps/eventviews-24.02.2
|
|
~kde-apps/grantlee-editor-24.02.2
|
|
~kde-apps/grantleetheme-24.02.2
|
|
~kde-apps/incidenceeditor-24.02.2
|
|
~kde-apps/kaddressbook-24.02.2
|
|
~kde-apps/kalarm-24.02.2
|
|
~kde-apps/kcalutils-24.02.2
|
|
~kde-apps/kdepim-addons-24.02.2
|
|
~kde-apps/kdepim-meta-24.02.2
|
|
~kde-apps/kdepim-runtime-24.02.2
|
|
~kde-apps/kidentitymanagement-24.02.2
|
|
~kde-apps/kimap-24.02.2
|
|
~kde-apps/kitinerary-24.02.2
|
|
~kde-apps/kldap-24.02.2
|
|
~kde-apps/kleopatra-24.02.2
|
|
~kde-apps/kmail-24.02.2
|
|
~kde-apps/kmail-account-wizard-24.02.2
|
|
~kde-apps/kmailtransport-24.02.2
|
|
~kde-apps/kmbox-24.02.2
|
|
~kde-apps/kmime-24.02.2
|
|
~kde-apps/knotes-24.02.2
|
|
~kde-apps/konsolekalendar-24.02.2
|
|
~kde-apps/kontact-24.02.2
|
|
~kde-apps/kontactinterface-24.02.2
|
|
~kde-apps/korganizer-24.02.2
|
|
~kde-apps/kpimtextedit-24.02.2
|
|
~kde-apps/kpkpass-24.02.2
|
|
~kde-apps/ksmtp-24.02.2
|
|
~kde-apps/libgravatar-24.02.2
|
|
~kde-apps/libkdepim-24.02.2
|
|
~kde-apps/libkgapi-24.02.2
|
|
~kde-apps/libkleo-24.02.2
|
|
~kde-apps/libksieve-24.02.2
|
|
~kde-apps/libktnef-24.02.2
|
|
~kde-apps/mailcommon-24.02.2
|
|
~kde-apps/mailimporter-24.02.2
|
|
~kde-apps/mbox-importer-24.02.2
|
|
~kde-apps/messagelib-24.02.2
|
|
~kde-apps/mimetreeparser-24.02.2
|
|
~kde-apps/pim-data-exporter-24.02.2
|
|
~kde-apps/pim-sieve-editor-24.02.2
|
|
~kde-apps/pimcommon-24.02.2
|
|
~kde-misc/zanshin-24.02.2
|
|
~kde-apps/dolphin-plugins-git-24.02.2
|
|
~kde-apps/dolphin-plugins-mercurial-24.02.2
|
|
~kde-apps/dolphin-plugins-subversion-24.02.2
|
|
~kde-apps/kapptemplate-24.02.2
|
|
~kde-apps/kcachegrind-24.02.2
|
|
~kde-apps/kde-dev-utils-24.02.2
|
|
~kde-apps/kdesdk-meta-24.02.2
|
|
~app-cdr/dolphin-plugins-mountiso-24.02.2
|
|
~app-cdr/isoimagewriter-24.02.2
|
|
~app-crypt/keysmith-24.02.2
|
|
~kde-apps/ark-24.02.2
|
|
~kde-apps/filelight-24.02.2
|
|
~kde-apps/kbackup-24.02.2
|
|
~kde-apps/kcalc-24.02.2
|
|
~kde-apps/kcharselect-24.02.2
|
|
~kde-apps/kdebugsettings-24.02.2
|
|
~kde-apps/kdeutils-meta-24.02.2
|
|
~kde-apps/kdf-24.02.2
|
|
~kde-apps/kgpg-24.02.2
|
|
~kde-apps/kteatime-24.02.2
|
|
~kde-apps/ktimer-24.02.2
|
|
~kde-apps/kwalletmanager-24.02.2
|
|
~kde-apps/sweeper-24.02.2
|
|
~kde-apps/yakuake-24.02.2
|
|
~kde-misc/kclock-24.02.2
|
|
~kde-misc/kweather-24.02.2
|
|
~kde-misc/markdownpart-24.02.2
|
|
~sys-block/partitionmanager-24.02.2
|
|
~sys-libs/kpmcore-24.02.2
|
|
=kde-apps/kio-extras-23.08.5-r100
|
|
=kde-misc/kio-gdrive-23.08.5-r1
|
|
=kde-plasma/print-manager-23.08.5-r100
|
|
~kde-misc/kio-fuse-5.1.0
|
|
~kde-misc/plasma-pass-1.2.2
|
|
~app-editors/kile-2.9.94
|
|
~dev-db/futuresql-0.1.1
|
|
~dev-libs/appstream-1.0.2
|
|
~dev-libs/kdiagram-3.0.1
|
|
~dev-libs/kirigami-addons-1.1.0
|
|
~dev-libs/ktextaddons-1.5.4
|
|
~dev-libs/kweathercore-0.8.0
|
|
~games-puzzle/skladnik-0.5.2
|
|
~gui-apps/xwaylandvideobridge-0.4.0
|
|
~kde-frameworks/oxygen-icons-6.0.0
|
|
=media-libs/kquickimageeditor-0.3.0-r100
|
|
~media-libs/libqaccessibilityclient-0.6.0
|
|
~media-libs/mpvqt-1.0.0
|
|
~media-libs/phonon-4.12.0
|
|
~media-libs/phonon-vlc-0.12.0
|
|
~media-libs/pulseaudio-qt-1.4.0
|
|
~net-libs/kdsoap-2.2.0
|
|
~net-libs/kdsoap-ws-discovery-client-0.4.0
|
|
~net-libs/signon-ui-0.15_p20231016
|
|
~net-libs/accounts-qt-1.17
|
|
~net-libs/accounts-qml-0.7_p20231028
|
|
~net-libs/signon-oauth2-0.25_p20210102
|
|
=net-libs/signond-8.61-r100
|
|
=net-misc/smb4k-3.2.5-r2
|
|
~sys-auth/polkit-qt-0.200.0
|
|
|
|
# Sam James <sam@gentoo.org> (2024-02-18)
|
|
# Lots of changes, including a port to a new build system. Needs lots of testing.
|
|
=sys-apps/gentoo-functions-1*
|
|
|
|
# Ulrich Müller <ulm@gentoo.org> (2024-02-08)
|
|
# Masked for testing.
|
|
# Test failure in watchpoints.dem, undefined function FresnelC.
|
|
~sci-visualization/gnuplot-6.0.0
|
|
|
|
# Patrick Lauer <patrick@gentoo.org> (2023-12-23)
|
|
# ROCm-6 builds but has runtime issues for me
|
|
>=dev-libs/roct-thunk-interface-6.0.0
|
|
>=dev-libs/rocr-runtime-6.0.0
|
|
>=dev-libs/rocm-comgr-6.0.0
|
|
>=dev-libs/rocm-device-libs-6.0.0
|
|
>=dev-libs/rocm-opencl-runtime-6.0.0
|
|
>=dev-util/hipcc-6.0.0
|
|
>=dev-util/hip-6.0.0
|
|
>=dev-util/rocminfo-6.0.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-12-14)
|
|
# Gentoo's kernel maintainers have decided to discontinue gentoo-sources and
|
|
# gentoo-kernel for old kernel LTS branches because of the resources to require
|
|
# testing and patching them, combined with changing kernel lifecycles.
|
|
#
|
|
# The new policy is to support kernels with genpatches for 3 years after their
|
|
# release.
|
|
#
|
|
# Specifically, 4.14/4.19/5.4 have been dropped. See https://www.mpagano.com/blog/?p=315
|
|
# and http://www.kroah.com/log/blog/2018/08/24/what-stable-kernel-should-i-use/.
|
|
#
|
|
# sys-kernel/vanilla-sources will continue to be provided for all branches
|
|
# until they reach formal upstream EOL.
|
|
#
|
|
<sys-kernel/gentoo-sources-5.10
|
|
<sys-kernel/gentoo-kernel-5.10
|
|
<virtual/dist-kernel-5.10
|
|
|
|
# Sam James <sam@gentoo.org> (2023-12-09)
|
|
# ext4 corruption bug: https://lore.kernel.org/stable/20231205122122.dfhhoaswsfscuhc3@quack3/ (bug #919675)
|
|
# Please update immediately to the latest versions in each series.
|
|
=sys-kernel/gentoo-sources-6.1.64
|
|
=sys-kernel/gentoo-sources-6.1.64-r1
|
|
=sys-kernel/gentoo-sources-6.1.65
|
|
=sys-kernel/gentoo-kernel-6.1.64
|
|
=sys-kernel/gentoo-kernel-6.1.64-r1
|
|
=sys-kernel/gentoo-kernel-6.1.65
|
|
=sys-kernel/vanilla-sources-6.1.64
|
|
=sys-kernel/vanilla-sources-6.1.65
|
|
=sys-kernel/vanilla-kernel-6.1.64
|
|
=sys-kernel/vanilla-kernel-6.1.65
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-22)
|
|
# Further bugs with CoW via copy_file_range (bug #917224, https://github.com/openzfs/zfs/issues/15526).
|
|
# The issue is very similar to bug #815469.
|
|
# ZFS 2.2.1 has a workaround but if you haven't already upgraded your pool to
|
|
# use the new block cloning feature, consider using <zfs-2.2 for now.
|
|
=sys-fs/zfs-2.2.0
|
|
=sys-fs/zfs-kmod-2.2.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-19)
|
|
# GCC 10 and older no longer receive upstream support or fixes for
|
|
# bugs. Please switch to a newer GCC version using gcc-config.
|
|
# The lowest supported version of GCC is GCC 11.
|
|
<sys-devel/gcc-11
|
|
<sys-devel/kgcc64-11
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-05)
|
|
# Mask broken versions:
|
|
# - sys-fs/btrfs-progs-6.6(-r0) was respun upstream.
|
|
# - sys-fs/btrfs-progs-6.6-r1 had the fixed tarball, but contained an upstream
|
|
# bug in the ioctl numbers.
|
|
# Please use sys-fs/btrfs-progs-6.6-r2 or, better, sys-fs/btrfs-progs-6.6.1
|
|
# (identical in functional contents).
|
|
=sys-fs/btrfs-progs-6.6
|
|
=sys-fs/btrfs-progs-6.6-r1
|
|
=sys-fs/btrfs-progs-6.6-r2
|
|
|
|
# Sam James <sam@gentoo.org> (2023-10-06)
|
|
# Breaks building scipy: https://github.com/cython/cython/issues/5748
|
|
=dev-python/cython-3.0.3
|
|
|
|
# Sam James <sam@gentoo.org> (2023-09-09)
|
|
# OpenSSL 1.1.x is EOL on 2023-09-11. Please upgrade immediately to >= OpenSSL 3.
|
|
# https://www.openssl.org/blog/blog/2023/03/28/1.1.1-EOL/
|
|
# https://www.openssl.org/blog/blog/2023/06/15/1.1.1-EOL-Reminder/
|
|
# Please run a full world upgrade, especially checking /etc/portage and your world file
|
|
# for old PHP or Ruby references.
|
|
<dev-libs/openssl-3
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2023-07-12)
|
|
# The catalyst-3 branch is outdated and not used by Gentoo
|
|
# Release Engineering anymore. Please either use git master
|
|
# (9999) as all Release Engineering build machines or wait
|
|
# for catalyst-4. Questions or bug reports about catalyst-3
|
|
# may or may not lead to useful results.
|
|
<dev-util/catalyst-4
|
|
|
|
# Matt Turner <mattst88@gentoo.org> (2023-07-06)
|
|
# GNOME 45 mask
|
|
>=gnome-extra/gnome-logs-45_alpha
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-06-21)
|
|
# suitesparseconfig-7.0.0 fails to build with multilib enabled
|
|
# because of dependencies that cannot be satisfied. All the other
|
|
# packages require it. Bug #908851.
|
|
=sci-libs/amd-3.0.3
|
|
=sci-libs/btf-2.0.3
|
|
=sci-libs/camd-3.0.3
|
|
=sci-libs/ccolamd-3.0.3
|
|
=sci-libs/cholmod-4.0.3
|
|
=sci-libs/colamd-3.0.3
|
|
=sci-libs/cxsparse-4.0.3
|
|
=sci-libs/klu-2.0.3
|
|
=sci-libs/ldl-3.0.3
|
|
=sci-libs/spqr-3.0.3
|
|
=sci-libs/suitesparseconfig-7.0.0
|
|
=sci-libs/umfpack-6.1.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-05-10)
|
|
# Lots of package breakage as usual for new versions. Masked until most/all
|
|
# reverse dependencies are fixed. Tracker bug is bug #906077.
|
|
=dev-libs/libfmt-10*
|
|
|
|
# Ionen Wolkens <ionen@gentoo.org> (2023-03-30)
|
|
# NVIDIA dropped support for the 390.xx branch in December 2022[1].
|
|
#
|
|
# Users are free to unmask and keep using, but be warned it is very
|
|
# likely to be affected by security issues as NVIDIA does not track
|
|
# nor fix these for this branch anymore.
|
|
#
|
|
# Gentoo will keep it packaged for as long as reasonably possible
|
|
# (albeit masked) but no true support will be given nor patches
|
|
# for newer kernels. It is recommended to use 6.1.x LTS kernels or
|
|
# older (6.1.x will be supported until at least December 2026).
|
|
#
|
|
# Major issues will lead to removal without further warning, e.g.
|
|
# if no usable kernels left in tree, or if broken with a newer Xorg.
|
|
#
|
|
# >> It is recommended to switch to nouveau[2] drivers (regardless
|
|
# of its worse performance), or ideally replace the hardware.
|
|
#
|
|
# [1] https://nvidia.custhelp.com/app/answers/detail/a_id/3142
|
|
# [2] https://wiki.gentoo.org/wiki/Nouveau
|
|
x11-drivers/nvidia-drivers:0/390
|
|
|
|
# Ben Kohler <bkohler@gentoo.org> (2023-01-30)
|
|
# Breaks too many revdeps for now
|
|
=app-text/discount-3*
|
|
|
|
# John Helmert III <ajak@gentoo.org> (2022-10-16)
|
|
# <OpenSSL-1.1.1 are EOL and contain known vulnerabilities. Users should
|
|
# migrate to a newer branch.
|
|
<dev-libs/openssl-1.1.1
|
|
|
|
# Joonas Niilola <juippis@gentoo.org> (2022-04-29)
|
|
# Apparently the "b" in version means "beta". 3.24 is available, we
|
|
# should update to that. #841437
|
|
~sci-physics/bullet-3.22b
|
|
|
|
# Brian Evans <grknight@gentoo.org> (2022-01-07)
|
|
# The main consumer, phpunit, does not initiate the new timer correctly
|
|
# This is likely to cause issues in tests; Unmask if using for other purposes
|
|
>=dev-php/PHP_Timer-5.0
|
|
|
|
# Volkmar W. Pogatzki <gentoo@pogatzki.net> (2021-11-23)
|
|
# Does not support updated dev-java/pdfbox-2.0.24, Bug #803488
|
|
# Blocks (CVE-2018-11797, CVE-2021-{27807,27906,31811,31812})
|
|
dev-tex/pdfannotextractor
|
|
|
|
# Ionen Wolkens <ionen@gentoo.org> (2021-10-09)
|
|
# Vulkan beta driver branch aimed at Vulkan developers for testing
|
|
# new features. Beside vulkan, it is typically behind the main branch
|
|
# and may be buggier or less secure. Only unmask if really wanted.
|
|
x11-drivers/nvidia-drivers:0/vulkan
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2021-09-18)
|
|
# dev-build/automake version 1.11 is EOL and is only useful for testing
|
|
# old de-ANSI-fication/ansi2knr/AM_C_PROTOTYPES code. Please uninstall.
|
|
dev-build/automake:1.11
|
|
|
|
# Joonas Niilola <juippis@gentoo.org> (2021-07-29)
|
|
# Upstream provided migration instructions from 2. -> 3. update,
|
|
# breaks if not all at least many revdeps. #805011 for tracker bug.
|
|
>=net-libs/mbedtls-3.0.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2021-07-06)
|
|
# Upstream changed license to GPL-3+ in order to deliberately cause
|
|
# incompatiblity with revdep licenses. Mask until the situation
|
|
# is resolved. Bug #791259.
|
|
>=media-libs/libopenaptx-0.2.1
|
|
|
|
# Sam James <sam@gentoo.org> (2021-03-30)
|
|
# Seems to break dev-tex/culmus-latex
|
|
# Masking until we can investigate & fix
|
|
# bug #737406
|
|
=media-fonts/culmus-0.133-r1
|
|
|
|
# Sam James <sam@gentoo.org> (2021-03-03)
|
|
# Doesn't seem to sync clock correctly
|
|
# in some cases.
|
|
# bug #772998
|
|
~net-misc/openntpd-6.8_p1
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2020-11-10)
|
|
# This old Kodi version requires vulnerable dev-python/pillow
|
|
# and prevents users from upgrading. Masked for the time being.
|
|
# Bug #729672.
|
|
media-plugins/kodi-game-libretro-nestopia
|
|
media-plugins/kodi-game-libretro-dosbox
|
|
|
|
# Sam James <sam@gentoo.org> (2020-10-05)
|
|
# Masked for testing. New major versions of Guile
|
|
# often break reverse dependencies.
|
|
# Guile in Gentoo is not slotted, so let's be cautious.
|
|
# bug #705554, bug #689408.
|
|
>=dev-scheme/guile-3.0.4
|
|
|
|
# Matt Turner <mattst88@gentoo.org> (2019-09-01)
|
|
# TeXmacs is the only remaining package in tree that requires guile-1.8, which
|
|
# is unsupported upstream. A TeXmacs port to Guile-2 has been in progress for a
|
|
# few years. Bug #436400
|
|
app-office/texmacs
|
|
<dev-scheme/guile-2
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2018-10-07)
|
|
# Masked for more testing especially of reverse-deps.
|
|
# ogre 1.11/1.12 breakage: bug #834468
|
|
# ogre 2.x breakage: bug #740424
|
|
>=dev-games/ogre-1.11.2
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2018-09-11)
|
|
# Mask transition ebuilds that were needed only for <glibc-2.26
|
|
# We will keep them in the tree as long as we have masked
|
|
# <glibc-2.26.
|
|
~net-libs/libnsl-0
|
|
~net-libs/rpcsvc-proto-0
|
|
|
|
# Nicolas Bock <nicolasbock@gentoo.org> (2017-10-31)
|
|
# There are multiple unresolved upstream issues with >=jabref-bin-4.0 (#636036).
|
|
# If you still would like to use this version, please report any issues to
|
|
# upstream.
|
|
>=app-text/jabref-bin-4.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2017-05-22)
|
|
# for Maciej S. Szmigiero <mail@maciej.szmigiero.name>
|
|
# Any version above 5.100.138 breaks b43 driver in various ways.
|
|
# Also, b43 wiki page says to use 5.100.138. Bug #541080.
|
|
>=sys-firmware/b43-firmware-6.30.163.46
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2017-05-21)
|
|
# (and others, updated later)
|
|
# These old versions of toolchain packages (binutils, gcc, glibc) are no
|
|
# longer officially supported and are not suitable for general use. Using
|
|
# these packages can result in build failures (and possible breakage) for
|
|
# many packages, and may leave your system vulnerable to known security
|
|
# exploits.
|
|
# If you still use one of these old toolchain packages, please upgrade (and
|
|
# switch the compiler / the binutils) ASAP. If you need them for a specific
|
|
# (isolated) use case, feel free to unmask them on your system.
|
|
<sys-libs/glibc-2.38-r10
|
|
<sys-libs/binutils-libs-2.40
|
|
<sys-devel/binutils-2.40
|
|
<sys-devel/binutils-hppa64-2.40
|
|
|
|
# Michael Orlitzky <mjo@gentoo.org> (2017-01-07)
|
|
# This package has some dangerous quality and security issues, but
|
|
# people may still find it useful. It is masked to prevent accidental
|
|
# use. See bugs 603346 and 604998 for more information.
|
|
app-admin/amazon-ec2-init
|
|
|
|
# Mike Gilbert <floppym@gentoo.org> (2014-03-04)
|
|
# Dev channel releases are only for people who are developers or want more
|
|
# experimental features and accept a more unstable release.
|
|
www-plugins/chrome-binary-plugins:unstable
|
|
|
|
# Diego E. Pettenò <flameeyes@gentoo.org> (2009-01-03)
|
|
# These packages are not supposed to be merged directly, instead
|
|
# please use sys-devel/crossdev to install them.
|
|
dev-util/mingw64-runtime
|
|
sys-libs/newlib
|
|
dev-embedded/avr-libc
|
|
sys-devel/nvptx-tools
|
|
sys-devel/clang-crossdev-wrappers
|