You can not select more than 25 topics
Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.
715 lines
26 KiB
715 lines
26 KiB
# Copyright 1999-2023 Gentoo Authors
|
|
# Distributed under the terms of the GNU General Public License v2
|
|
|
|
####################################################################
|
|
#
|
|
# When you add an entry to the top of this file, add your name, the date
|
|
# in the UTC timezone with a format of YYYY-MM-DD, and an explanation of why
|
|
# something is getting masked.
|
|
# Please be extremely careful not to commit atoms that are not valid, as it can
|
|
# cause large-scale breakage, especially if it ends up in the daily snapshot.
|
|
#
|
|
## Example:
|
|
##
|
|
## # Dev E. Loper <developer@gentoo.org> (2019-07-01)
|
|
## # Masking these versions until we can get the
|
|
## # v4l stuff to work properly again
|
|
## =media-video/mplayer-0.90_pre5
|
|
## =media-video/mplayer-0.90_pre5-r1
|
|
#
|
|
# - Best last rites (removal) practices -
|
|
# Include the following info:
|
|
# a) reason for masking
|
|
# b) bug # for the removal (and yes you should have one)
|
|
# c) date of removal (either the date or "in x days")
|
|
#
|
|
## Example:
|
|
##
|
|
## # Dev E. Loper <developer@gentoo.org> (2019-07-01)
|
|
## # Masked for removal in 30 days. Doesn't work
|
|
## # with new libfoo. Upstream dead, gtk-1, smells
|
|
## # funny. (bug #987654)
|
|
## app-misc/some-package
|
|
|
|
#--- END OF EXAMPLES ---
|
|
|
|
# Hans de Graaff <graaff@gentoo.org> (2023-12-10)
|
|
# Test failures that seem to indicate this package no longer works
|
|
# correctly. Last release 6 years ago. No reverse dependencies.
|
|
# Masked for removal on 2024-01-10.
|
|
dev-ruby/sinatra-partial
|
|
|
|
# Sam James <sam@gentoo.org> (2023-12-09)
|
|
# ext4 corruption bug: https://lore.kernel.org/stable/20231205122122.dfhhoaswsfscuhc3@quack3/ (bug #919675)
|
|
# Please update immediately to the latest versions in each series.
|
|
=sys-kernel/gentoo-sources-6.1.64
|
|
=sys-kernel/gentoo-sources-6.1.64-r1
|
|
=sys-kernel/gentoo-sources-6.1.65
|
|
=sys-kernel/gentoo-kernel-6.1.64
|
|
=sys-kernel/gentoo-kernel-6.1.64-r1
|
|
=sys-kernel/gentoo-kernel-6.1.65
|
|
=sys-kernel/vanilla-sources-6.1.64
|
|
=sys-kernel/vanilla-sources-6.1.65
|
|
=sys-kernel/vanilla-kernel-6.1.64
|
|
=sys-kernel/vanilla-kernel-6.1.65
|
|
|
|
# Hans de Graaff <graaff@gentoo.org> (2023-12-09)
|
|
# Old slots that are not ruby32-compatible. No reverse dependencies
|
|
# left. Please use the newer slot instead. Masked for removal on
|
|
# 2024-01-09.
|
|
dev-ruby/gettext-setup:0
|
|
dev-ruby/fast_gettext:0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-12-08)
|
|
# The both remaining virtuals are deprecated in favor of using
|
|
# python_gen_cond_dep directly, and no longer used in any packages
|
|
# in ::gentoo.
|
|
# Removal on 2024-01-07. Bug #919467.
|
|
virtual/python-cffi
|
|
virtual/python-greenlet
|
|
|
|
# Sam James <sam@gentoo.org> (2023-12-08)
|
|
# Broken build system:
|
|
# https://github.com/iovisor/bcc/issues/4823
|
|
# https://github.com/iovisor/bcc/issues/4830
|
|
=dev-util/bcc-0.29.0
|
|
|
|
# Hans de Graaff <graaff@gentoo.org> (2023-12-06)
|
|
# Copy of dev-ruby/listen spefically for dev-ruby/sass. That package now
|
|
# uses dev-ruby/listen directly so there is no longer a need for
|
|
# sass-listen. Masked for removal on 2024-01-06.
|
|
dev-ruby/sass-listen
|
|
|
|
# Hans de Graaff <graaff@gentoo.org> (2023-12-06)
|
|
# Last release in 2015, not compatible with Ruby 3.2. No reverse
|
|
# dependencies. Masked for removal on 2024-01-06.
|
|
dev-ruby/semver2
|
|
|
|
# Eli Schwartz <eschwartz93@gmail.com> (2023-12-02)
|
|
# Has a bug that breaks sys-apps/portage. Upgrade to 1.3.0-r1 instead.
|
|
# Bug #919072.
|
|
=dev-util/meson-1.3.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-30)
|
|
# Last commit in 2020. It was used exclusively by dev-python/ipython,
|
|
# and it is used no more.
|
|
# Removal on 2023-12-30. Bug #916535.
|
|
dev-python/backcall
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-30)
|
|
# Originally added for net-im/synapse, which switched
|
|
# to dev-python/immutabledict since. Hacky C extension that supports
|
|
# up to Python 3.10. No revdeps left.
|
|
# Removal on 2023-12-30. Bug #918899.
|
|
dev-python/frozendict
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-29)
|
|
# Breaks dev-python/passlib (bug #918708). This release has also now been
|
|
# yanked from pypi: https://github.com/pyca/bcrypt/issues/677.
|
|
=dev-python/bcrypt-4.1.0
|
|
|
|
# John Helmert III <ajak@gentoo.org> (2023-11-25)
|
|
# Multiple vulnerabilities, unmaintained upstream and in Gentoo.
|
|
# subtitleripper included as sole reverse dependency, similarly
|
|
# unmaintained, and with no other reverse dependencies.
|
|
# Removal on 2023-12-24, bug #824290.
|
|
app-text/gocr
|
|
media-video/subtitleripper
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-25)
|
|
# Breaks desktop icon rendering, see bug #904468.
|
|
# Upstream bug: https://gitlab.xfce.org/xfce/xfdesktop/-/issues/242
|
|
=xfce-base/xfdesktop-4.19.1
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-22)
|
|
# Further bugs with CoW via copy_file_range (bug #917224, https://github.com/openzfs/zfs/issues/15526).
|
|
# The issue is very similar to bug #815469.
|
|
# ZFS 2.2.1 has a workaround but if you haven't already upgraded your pool to
|
|
# use the new block cloning feature, consider using <zfs-2.2 for now.
|
|
=sys-fs/zfs-2.2.0
|
|
=sys-fs/zfs-kmod-2.2.0
|
|
|
|
# hololeap <hololeap@protonmail.com> (2023-11-19)
|
|
# Package has been masked for a long time, is useless for ::gentoo, and has no
|
|
# reverse dependencies.
|
|
# Removal on 2023-12-19.
|
|
dev-haskell/doctest-parallel
|
|
|
|
# hololeap <hololeap@protonmail.com> (2023-11-19)
|
|
# Bundled library for GHC, exposed as an ebuild for historical reasons.
|
|
# No reverse dependencies, no longer needed in ::gentoo tree.
|
|
# See: <https://github.com/gentoo-haskell/gentoo-haskell/issues/1464>
|
|
# Removal on 2023-12-19.
|
|
dev-haskell/terminfo
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-19)
|
|
# GCC 10 and older no longer receive upstream support or fixes for
|
|
# bugs. Please switch to a newer GCC version using gcc-config.
|
|
# The lowest supported version of GCC is GCC 11.
|
|
<sys-devel/gcc-11
|
|
<sys-devel/kgcc64-11
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-18)
|
|
# Lots of applications need porting, bug #917537.
|
|
>=dev-libs/libxml2-2.12.0
|
|
|
|
# Arthur Zamarin <arthurzam@gentoo.org> (2023-11-10)
|
|
# No reverse dependencies, no tests, no upstream activity. All ebuild
|
|
# maintenance on this package was done randomly by @python project members,
|
|
# at late stage of python porting, which is hard with no tests.
|
|
# Removal on 2023-12-10. Bug #917124.
|
|
dev-python/empy
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-06)
|
|
# Unmaintained. Last commit in 2017. Distutils is deprecated.
|
|
# No revdeps.
|
|
# Removal on 2023-12-06. Bug #916968.
|
|
dev-python/pyqt-distutils
|
|
|
|
# Sam James <sam@gentoo.org> (2023-11-05)
|
|
# Mask broken versions:
|
|
# - sys-fs/btrfs-progs-6.6(-r0) was respun upstream.
|
|
# - sys-fs/btrfs-progs-6.6-r1 had the fixed tarball, but contained an upstream
|
|
# bug in the ioctl numbers.
|
|
# Please use sys-fs/btrfs-progs-6.6-r2 or, better, sys-fs/btrfs-progs-6.6.1
|
|
# (identical in functional contents).
|
|
=sys-fs/btrfs-progs-6.6
|
|
=sys-fs/btrfs-progs-6.6-r1
|
|
=sys-fs/btrfs-progs-6.6-r2
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-05)
|
|
# Discontinued upstream. Fails tests with modern pytest.
|
|
# No revdeps left.
|
|
# Removal on 2023-12-05. Bug #906834.
|
|
dev-python/pytest-subtesthack
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-05)
|
|
# Discontinued in favor of built-in support in setuptools-scm-7.
|
|
# No revdeps left.
|
|
# Removal on 2023-12-05. Bug #916904.
|
|
dev-python/setuptools_scm_git_archive
|
|
|
|
# Mart Raudsepp <leio@gentoo.org> (2023-11-04)
|
|
# gst-transcoder was merged into gst-plugins-bad and can be installed via
|
|
# media-libs/gst-plugins-bad instead. Removal on 2023-12-04. Bug #916871.
|
|
media-plugins/gst-transcoder
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-04)
|
|
# Broken on py3.12. Last commit in 2020. Already a second fork
|
|
# of the package. No revdeps.
|
|
# Removal on 2023-12-04. Bug #916856.
|
|
dev-python/wstools
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-29)
|
|
# This version contains a major bug that causes pytest internal error
|
|
# when tests are skippeed at module level.
|
|
# https://github.com/pytest-dev/pytest-asyncio/issues/655
|
|
=dev-python/pytest-asyncio-0.22.0
|
|
|
|
# Tomáš Mózes <hydrapolic@gmail.com> (2023-11-02)
|
|
# Performance regression. Bug #916713.
|
|
=dev-db/mydumper-0.15.1.3
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-11-01)
|
|
# Broken on py3.12. Repository archived upstream. No revdeps.
|
|
# Removal on 2023-12-01. Bug #916670.
|
|
dev-python/pushbullet-py
|
|
|
|
# Michael Orlitzky <mjo@gentoo.org> (2023-10-31)
|
|
# Sabayon upstream (dead). No meaningful maintenance since we
|
|
# switched to git. All other aws-*-tools packages were removed
|
|
# in 2018. Removal on or after 2023-12-01.
|
|
app-admin/aws-elb-tools
|
|
|
|
# Guilherme Amadio <amadio@gentoo.org> (2023-10-30)
|
|
# net-libs/xrootd-ceph was split from net-libs/xrootd as a git
|
|
# submodule, but has been merged back to the main repository in
|
|
# net-libs/xrootd-5.6.0. Please switch to net-libs/xrootd[ceph]
|
|
# instead of net-libs/xrootd-ceph. Removal on 2023-11-30.
|
|
net-libs/xrootd-ceph
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-29)
|
|
# Backports from Python 3.6/3.7 to Python 3.5. Finally the last revdep
|
|
# is gone.
|
|
# Removal on 2023-11-28. Bug #916485.
|
|
dev-python/async_generator
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2023-10-28)
|
|
# Fails to build with glibc-2.38 (and musl). No maintainer.
|
|
# Removal on 2023-11-28. Bug #713402
|
|
app-editors/fte
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-27)
|
|
# dev-games/cegui is unmaintained, does not support Python 3.11 and has
|
|
# a ton of open bugs. It is only used by games-rpg/sumwars. CeGUI has
|
|
# had no release since 2016, and apparently the current git
|
|
# is incompatible with SumWars. SumWars have had no activity
|
|
# since 2014.
|
|
# Removal on 2023-11-26. Bug #896688.
|
|
dev-games/cegui
|
|
games-rpg/sumwars
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-27)
|
|
# The package does not work with any of the dev-python/ruamel-yaml
|
|
# versions in ::gentoo. No revdeps.
|
|
# Removal on 2023-11-26. Bug #915986.
|
|
dev-python/yamlpath
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Non-installable since the distfile is gone and the package
|
|
# is mirror-restricted.
|
|
# Removal on 2023-11-25. Bug #753515.
|
|
games-strategy/defcon-demo
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# An unmaintained programming language with last release in 2009.
|
|
# Multiple bugs reported. No revdeps.
|
|
# Removal on 2023-11-25.
|
|
dev-lang/ferite
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Obsolete package for GRUB 1.x. No updates since 2009, multiple bugs
|
|
# reported.
|
|
# Removal on 2023-11-25. Bug #912684.
|
|
media-gfx/grub-splashes
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Dead (and discouraged prior to death). No revdeps.
|
|
# Removal on 2023-11-25. Bug #912879.
|
|
dev-php/securimage
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Not installable due to conflict with sys-apps/coreutils.
|
|
# Removal on 2023-11-25. Bug #908406.
|
|
app-misc/realpath
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Hyperdex "support libraries". Hyperdex was removed in 2020.
|
|
# No revdeps outside the bunch.
|
|
# Removal on 2023-11-25. Bug #527386.
|
|
dev-libs/busybee
|
|
dev-libs/libe
|
|
dev-libs/libpo6
|
|
dev-libs/libtreadstone
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Fails to compile with modern C++ compilers. Last release in 2011.
|
|
# No revdeps.
|
|
# Removal on 2023-11-25. Bug #722006.
|
|
sci-electronics/freehdl
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-26)
|
|
# Incompatible with Cython 3. Last commit in 2016. No revdeps.
|
|
# Removal on 2023-11-25. Bug #898696.
|
|
dev-python/plyr
|
|
|
|
# Marek Szuba <marecki@gentoo.org> (2023-10-26)
|
|
# Upstream uses a massive home-made Makefile which has since the beginning
|
|
# required massive amounts of patching to make it behave reasonably
|
|
# (as well as to fix the problems which ostensibly led upstream to
|
|
# abandoning CMake, and which they immediately re-introduced in their NIH
|
|
# solution) and which if anything have only got worse since then. One,
|
|
# optional, reverse dependency in the tree.
|
|
# Removal on 2023-11-26. Bug #916289.
|
|
media-gfx/gmic
|
|
|
|
# Volkmar W. Pogatzki <gentoo@pogatzki.net> (2023-10-23)
|
|
# Java libraries. No reverse dependencies.
|
|
# Removal on 2023-11-23.
|
|
dev-java/apache-rat-core
|
|
dev-java/apache-rat-tasks
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-23)
|
|
# Broken on Python 3.11. Archived upstream since 2020. No revdeps.
|
|
# Removal on 2023-11-22. Bug #896886.
|
|
dev-python/sphinx-testing
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-22)
|
|
# Incompatible with Python 3.12. Last commit in 2016. No revdeps.
|
|
# Removal on 2023-11-21. Bug #909917.
|
|
dev-python/exam
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-20)
|
|
# The test suite is broken and does not fail correctly. No maintainer.
|
|
# No revdeps.
|
|
# Removal on 2023-11-19. Bug #916047.
|
|
dev-python/pydotplus
|
|
|
|
# Ulrich Müller <ulm@gentoo.org> (2023-10-19)
|
|
# Pretest versions, masked for testing.
|
|
<app-editors/emacs-29.1.9999:29-vcs
|
|
|
|
# Sam James <sam@gentoo.org> (2023-10-16)
|
|
# Part of Perl core and better maintained there - the version on CPAN is out of
|
|
# date and incompatible with Perl 5.38. No reverse dependencies.
|
|
# Removal on 2023-11-15.
|
|
dev-perl/PathTools
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-15)
|
|
# These packages were required by old version of dev-python/jupyterlab
|
|
# and dev-python/notebook, and are no longer used.
|
|
# Removal on 2023-11-14. Bug #915824.
|
|
dev-python/check-manifest
|
|
dev-python/jupyter-server-fileid
|
|
dev-python/jupyter-server-ydoc
|
|
dev-python/jupyter-ydoc
|
|
dev-python/y-py
|
|
dev-python/ypy-websocket
|
|
|
|
# Mart Raudsepp <leio@gentoo.org> (2023-10-14)
|
|
# The database used by this music fingerprint library has been defunct for
|
|
# a while. Removal on 2023-11-13. Bug #915190.
|
|
media-libs/libofa
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-10-14)
|
|
# media-video/transcode is dead for many years. We already piled up
|
|
# a lot of downstream patches just to keep it working, and it's broken
|
|
# again (ffmpeg-5 this time). The mask includes revdeps.
|
|
# Removal on 2023-11-13. Bug #861311.
|
|
app-cdr/dvdshrink
|
|
media-plugins/vdr-burn
|
|
media-plugins/vdr-burn-templates
|
|
media-video/dvd9to5
|
|
media-video/dvdrip
|
|
media-video/transcode
|
|
|
|
# Sam James <sam@gentoo.org> (2023-10-06)
|
|
# Breaks building scipy: https://github.com/cython/cython/issues/5748
|
|
=dev-python/cython-3.0.3
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-09-22)
|
|
# =dev-python/setuptools-scm-8.0.1 broke compatibility hard but reverted
|
|
# the changes in 8.0.2.
|
|
~dev-python/setuptools-scm-8.0.1
|
|
|
|
# Jaco Kroon <jaco@uls.co.za> (2023-09-19)
|
|
# Joonas Niilola <juippis@gentoo.org> (2023-09-21)
|
|
# DAHDI is not suited for a rolling-release distribution. Upstream releases new
|
|
# versions sporadically and it may take multiple years between them. Old
|
|
# versions are constantly broken with newer kernels, requiring heavy patching
|
|
# downstream. Has no active maintainer in Gentoo. If you use DAHDI and have
|
|
# some ideas how to help, please see bug #914477.
|
|
# Removal on 2024-03-01.
|
|
net-libs/libpri
|
|
net-misc/dahdi
|
|
net-misc/dahdi-tools
|
|
net-misc/openr2
|
|
|
|
# Sam James <sam@gentoo.org> (2023-09-09)
|
|
# OpenSSL 1.1.x is EOL on 2023-09-11. Please upgrade immediately to >= OpenSSL 3.
|
|
# https://www.openssl.org/blog/blog/2023/03/28/1.1.1-EOL/
|
|
# https://www.openssl.org/blog/blog/2023/06/15/1.1.1-EOL-Reminder/
|
|
# Please run a full world upgrade, especially checking /etc/portage and your world file
|
|
# for old PHP or Ruby references.
|
|
<dev-libs/openssl-3
|
|
<app-crypt/xca-2.4.0_p20230526
|
|
|
|
# Sam James <sam@gentoo.org> (2023-08-04)
|
|
# Stricter behavior which causes some packages to fail, see bug #911721.
|
|
=dev-util/pkgconf-2.0.0
|
|
|
|
# Mike Pagano <mpagano@gentoo.org> (2023-07-18)
|
|
# Mask impacted kernels vulnerable to StackRot and
|
|
# ones with a memory corruption bug
|
|
# Bug #909829, #794547.
|
|
=sys-kernel/gentoo-kernel-6.1.28
|
|
=sys-kernel/gentoo-kernel-6.1.37*
|
|
=sys-kernel/gentoo-kernel-6.3*
|
|
=sys-kernel/gentoo-kernel-bin-6.1.28
|
|
=sys-kernel/gentoo-kernel-bin-6.1.37*
|
|
=sys-kernel/gentoo-kernel-bin-6.3*
|
|
=sys-kernel/gentoo-sources-6.1.28
|
|
=sys-kernel/gentoo-sources-6.1.37*
|
|
=sys-kernel/gentoo-sources-6.4.0
|
|
=sys-kernel/gentoo-sources-6.4.1*
|
|
=sys-kernel/gentoo-sources-6.4.2
|
|
=sys-kernel/vanilla-kernel-6.1.28
|
|
=sys-kernel/vanilla-kernel-6.1.37*
|
|
=sys-kernel/vanilla-kernel-6.3*
|
|
=sys-kernel/vanilla-sources-6.1.28
|
|
=sys-kernel/vanilla-sources-6.1.37*
|
|
=sys-kernel/vanilla-sources-6.3*
|
|
=sys-kernel/vanilla-sources-6.4.0
|
|
=sys-kernel/vanilla-sources-6.4.1*
|
|
=sys-kernel/vanilla-sources-6.4.2
|
|
=virtual/dist-kernel-6.1.28
|
|
=virtual/dist-kernel-6.1.37*
|
|
=virtual/dist-kernel-6.3*
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2023-07-12)
|
|
# The catalyst-3 branch is outdated and not used by Gentoo
|
|
# Release Engineering anymore. Please either use git master
|
|
# (9999) as all Release Engineering build machines or wait
|
|
# for catalyst-4. Questions or bug reports about catalyst-3
|
|
# may or may not lead to useful results.
|
|
<dev-util/catalyst-4
|
|
|
|
# Matt Turner <mattst88@gentoo.org> (2023-07-06)
|
|
# GNOME 45 mask
|
|
>=gnome-extra/gnome-logs-45_alpha
|
|
>=x11-libs/pango-1.51.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-07-05)
|
|
# Doesn't install all needed files by e.g. kernelshark.
|
|
# Need to either split into libtracecmd for the libraries or revert to Makefiles.
|
|
# See bug #909439.
|
|
=dev-util/trace-cmd-3.2
|
|
|
|
# Sam James <sam@gentoo.org> (2023-06-03)
|
|
# Breaks dev-perl/Spreadsheet-ParseExcel, see bug #909564.
|
|
# Please upgrade to >=dev-perl/dev-perl/OLE-StorageLite-0.220.0.
|
|
=dev-perl/OLE-StorageLite-0.210.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-06-21)
|
|
# suitesparseconfig-7.0.0 fails to build with multilib enabled
|
|
# because of dependencies that cannot be satisfied. All the other
|
|
# packages require it. Bug #908851.
|
|
=sci-libs/amd-3.0.3
|
|
=sci-libs/btf-2.0.3
|
|
=sci-libs/camd-3.0.3
|
|
=sci-libs/ccolamd-3.0.3
|
|
=sci-libs/cholmod-4.0.3
|
|
=sci-libs/colamd-3.0.3
|
|
=sci-libs/cxsparse-4.0.3
|
|
=sci-libs/klu-2.0.3
|
|
=sci-libs/ldl-3.0.3
|
|
=sci-libs/spqr-3.0.3
|
|
=sci-libs/suitesparseconfig-7.0.0
|
|
=sci-libs/umfpack-6.1.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-06-16)
|
|
# Please upgrade to >=app-admin/eselect-1.4.22-r1 for a fix to env-update
|
|
# and the files it generates in /etc/env.d: bug #908401, then run env-update
|
|
# and . /etc/profile.
|
|
<app-admin/eselect-1.4.22-r1
|
|
|
|
# Tomáš Mózes <hydrapolic@gmail.com> (2023-06-12)
|
|
# Buggy version that causes ibdata1 to grow, please update. See bug #908394.
|
|
=dev-db/mariadb-10.5.20
|
|
=dev-db/mariadb-10.6.13
|
|
=dev-db/mariadb-10.11.2
|
|
=dev-db/mariadb-10.11.3
|
|
|
|
# Sam James <sam@gentoo.org> (2023-05-10)
|
|
# Lots of package breakage as usual for new versions. Masked until most/all
|
|
# reverse dependencies are fixed. Tracker bug is bug #906077.
|
|
=dev-libs/libfmt-10*
|
|
|
|
# Sam James <sam@gentoo.org> (2023-05-01)
|
|
# Breaks dev-python/scipy build. See bug #905396 and https://github.com/serge-sans-paille/gast/issues/74.
|
|
=dev-python/pythran-0.13.0
|
|
=dev-python/gast-0.5.4
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2023-04-30)
|
|
# Breaking even latest ~arch version of KDE PIM, bug #905352.
|
|
=dev-libs/ktextaddons-1.3*
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2023-04-18)
|
|
# Breaks ABI without SOVERSION bump, effectively preventing
|
|
# xfce4-terminal from starting.
|
|
# https://bugs.gentoo.org/904500
|
|
=xfce-base/libxfce4ui-4.19.0
|
|
|
|
# Sam James <sam@gentoo.org> (2023-04-16)
|
|
# SEEK_HOLE issues causing corruption with (sparse?) copies again.
|
|
# See https://github.com/openzfs/zfs/issues/14753.
|
|
=sys-fs/zfs-kmod-2.1.10
|
|
|
|
# Sam James <sam@gentoo.org> (2023-04-13)
|
|
# Leads to broken terminal output in e.g. vim and openrc and other applications
|
|
# like joe crashing.
|
|
# Bugs:
|
|
# - reported at bottom of bug #904247 and bug #904263
|
|
# - app-misc/tmux: https://github.com/tmux/tmux/issues/3531
|
|
# - sys-apps/openrc: https://github.com/OpenRC/openrc/issues/619
|
|
=sys-libs/ncurses-6.4_p20230424
|
|
=sys-libs/ncurses-6.4_p20230506
|
|
=sys-libs/ncurses-6.4_p20230527
|
|
|
|
# Eray Aslan <eras@gentoo.org> (2023-04-12)
|
|
# Mask experimental software
|
|
=mail-mta/postfix-3.9*
|
|
|
|
# Ionen Wolkens <ionen@gentoo.org> (2023-03-30)
|
|
# NVIDIA dropped support for the 390.xx branch in December 2022[1].
|
|
#
|
|
# Users are free to unmask and keep using, but be warned it is very
|
|
# likely to be affected by security issues as NVIDIA does not track
|
|
# nor fix these for this branch anymore.
|
|
#
|
|
# Gentoo will keep it packaged for as long as reasonably possible
|
|
# (albeit masked) but no true support will be given nor patches
|
|
# for newer kernels. It is recommended to use 6.1.x LTS kernels or
|
|
# older (6.1.x will be supported until at least December 2026).
|
|
#
|
|
# Major issues will lead to removal without further warning, e.g.
|
|
# if no usable kernels left in tree, or if broken with a newer Xorg.
|
|
#
|
|
# >> It is recommended to switch to nouveau[2] drivers (regardless
|
|
# of its worse performance), or ideally replace the hardware.
|
|
#
|
|
# [1] https://nvidia.custhelp.com/app/answers/detail/a_id/3142
|
|
# [2] https://wiki.gentoo.org/wiki/Nouveau
|
|
x11-drivers/nvidia-drivers:0/390
|
|
|
|
# Sam James <sam@gentoo.org> (2023-03-29)
|
|
# Regressions in solving ability affecting e.g. igraph:
|
|
# https://github.com/opencollab/arpack-ng/issues/401
|
|
# https://github.com/opencollab/arpack-ng/issues/410
|
|
# https://github.com/opencollab/arpack-ng/issues/411
|
|
# https://github.com/igraph/igraph/issues/2311
|
|
=sci-libs/arpack-3.9.0
|
|
|
|
# Mike Pagano <mpagano@gentoo.org> (2023-03-10)
|
|
# Mask =sys-kernel/gentoo-sources-5.15.99 since it does
|
|
# not include 5.15.99 and is misleading
|
|
=sys-kernel/gentoo-sources-5.15.99
|
|
|
|
# Torokhov Sergey <torokhov-s-a@yandex.ru> (2023-02-26)
|
|
# The masked version causes GIMP breaking of Cut/Copy/Paste
|
|
# https://gitlab.gnome.org/GNOME/gimp/-/issues/9175
|
|
=media-libs/babl-0.1.100
|
|
|
|
# Ben Kohler <bkohler@gentoo.org> (2023-01-30)
|
|
# Breaks too many revdeps for now
|
|
=app-text/discount-3*
|
|
|
|
# John Helmert III <ajak@gentoo.org> (2022-10-16)
|
|
# <OpenSSL-1.1.1 are EOL and contain known vulnerabilities. Users should
|
|
# migrate to a newer branch.
|
|
<dev-libs/openssl-1.1.1
|
|
|
|
# John Helmert III <ajak@gentoo.org> (2022-09-18)
|
|
# Unfixed root privilege escalation, bug #631552
|
|
sys-cluster/slurm
|
|
|
|
# Joonas Niilola <juippis@gentoo.org> (2022-04-29)
|
|
# Apparently the "b" in version means "beta". 3.24 is available, we
|
|
# should update to that. #841437
|
|
~sci-physics/bullet-3.22b
|
|
|
|
# Brian Evans <grknight@gentoo.org> (2022-01-07)
|
|
# The main consumer, phpunit, does not initiate the new timer correctly
|
|
# This is likely to cause issues in tests; Unmask if using for other purposes
|
|
>=dev-php/PHP_Timer-5.0
|
|
|
|
# Volkmar W. Pogatzki <gentoo@pogatzki.net> (2021-11-23)
|
|
# Does not support updated dev-java/pdfbox-2.0.24, Bug #803488
|
|
# Blocks (CVE-2018-11797, CVE-2021-{27807,27906,31811,31812})
|
|
dev-tex/pdfannotextractor
|
|
|
|
# Ionen Wolkens <ionen@gentoo.org> (2021-10-09)
|
|
# Vulkan beta driver branch aimed at Vulkan developers for testing
|
|
# new features. Beside vulkan, it is typically behind the main branch
|
|
# and may be buggier or less secure. Only unmask if really wanted.
|
|
x11-drivers/nvidia-drivers:0/vulkan
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2021-09-18)
|
|
# sys-devel/automake version 1.11 is EOL and is only useful for testing
|
|
# old de-ANSI-fication/ansi2knr/AM_C_PROTOTYPES code. Please uninstall.
|
|
sys-devel/automake:1.11
|
|
|
|
# Joonas Niilola <juippis@gentoo.org> (2021-07-29)
|
|
# Upstream provided migration instructions from 2. -> 3. update,
|
|
# breaks if not all at least many revdeps. #805011 for tracker bug.
|
|
>=net-libs/mbedtls-3.0.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2021-07-06)
|
|
# Upstream changed license to GPL-3+ in order to deliberately cause
|
|
# incompatiblity with revdep licenses. Mask until the situation
|
|
# is resolved. Bug #791259.
|
|
>=media-libs/libopenaptx-0.2.1
|
|
|
|
# Sam James <sam@gentoo.org> (2021-03-30)
|
|
# Seems to break dev-tex/culmus-latex
|
|
# Masking until we can investigate & fix
|
|
# bug #737406
|
|
=media-fonts/culmus-0.133-r1
|
|
|
|
# Sam James <sam@gentoo.org> (2021-03-03)
|
|
# Doesn't seem to sync clock correctly
|
|
# in some cases.
|
|
# bug #772998
|
|
~net-misc/openntpd-6.8_p1
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2020-11-10)
|
|
# This old Kodi version requires vulnerable dev-python/pillow
|
|
# and prevents users from upgrading. Masked for the time being.
|
|
# Bug #729672.
|
|
media-plugins/kodi-game-libretro-nestopia
|
|
media-plugins/kodi-game-libretro-dosbox
|
|
|
|
# Sam James <sam@gentoo.org> (2020-10-05)
|
|
# Masked for testing. New major versions of Guile
|
|
# often break reverse dependencies.
|
|
# Guile in Gentoo is not slotted, so let's be cautious.
|
|
# bug #705554, bug #689408.
|
|
>=dev-scheme/guile-3.0.4
|
|
|
|
# Matt Turner <mattst88@gentoo.org> (2019-09-01)
|
|
# TeXmacs is the only remaining package in tree that requires guile-1.8, which
|
|
# is unsupported upstream. A TeXmacs port to Guile-2 has been in progress for a
|
|
# few years. Bug #436400
|
|
app-office/texmacs
|
|
<dev-scheme/guile-2
|
|
|
|
# Andreas Sturmlechner <asturm@gentoo.org> (2018-10-07)
|
|
# Masked for more testing especially of reverse-deps.
|
|
# ogre 1.11/1.12 breakage: bug #834468
|
|
# ogre 2.x breakage: bug #740424
|
|
>=dev-games/ogre-1.11.2
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2018-09-11)
|
|
# Mask transition ebuilds that were needed only for <glibc-2.26
|
|
# We will keep them in the tree as long as we have masked
|
|
# <glibc-2.26.
|
|
~net-libs/libnsl-0
|
|
~net-libs/rpcsvc-proto-0
|
|
|
|
# Nicolas Bock <nicolasbock@gentoo.org> (2017-10-31)
|
|
# There are multiple unresolved upstream issues with >=jabref-bin-4.0 (#636036).
|
|
# If you still would like to use this version, please report any issues to
|
|
# upstream.
|
|
>=app-text/jabref-bin-4.0
|
|
|
|
# Michał Górny <mgorny@gentoo.org> (2017-05-22)
|
|
# for Maciej S. Szmigiero <mail@maciej.szmigiero.name>
|
|
# Any version above 5.100.138 breaks b43 driver in various ways.
|
|
# Also, b43 wiki page says to use 5.100.138. Bug #541080.
|
|
>=sys-firmware/b43-firmware-6.30.163.46
|
|
|
|
# Andreas K. Hüttel <dilfridge@gentoo.org> (2017-05-21)
|
|
# (and others, updated later)
|
|
# These old versions of toolchain packages (binutils, gcc, glibc) are no
|
|
# longer officially supported and are not suitable for general use. Using
|
|
# these packages can result in build failures (and possible breakage) for
|
|
# many packages, and may leave your system vulnerable to known security
|
|
# exploits.
|
|
# If you still use one of these old toolchain packages, please upgrade (and
|
|
# switch the compiler / the binutils) ASAP. If you need them for a specific
|
|
# (isolated) use case, feel free to unmask them on your system.
|
|
<sys-libs/glibc-2.37-r3
|
|
<sys-libs/binutils-libs-2.40
|
|
<sys-devel/binutils-2.40
|
|
<sys-devel/binutils-hppa64-2.40
|
|
|
|
# Michael Orlitzky <mjo@gentoo.org> (2017-01-07)
|
|
# This package has some dangerous quality and security issues, but
|
|
# people may still find it useful. It is masked to prevent accidental
|
|
# use. See bugs 603346 and 604998 for more information.
|
|
app-admin/amazon-ec2-init
|
|
|
|
# Mike Gilbert <floppym@gentoo.org> (2014-03-04)
|
|
# Dev channel releases are only for people who are developers or want more
|
|
# experimental features and accept a more unstable release.
|
|
www-plugins/chrome-binary-plugins:unstable
|
|
|
|
# Diego E. Pettenò <flameeyes@gentoo.org> (2009-01-03)
|
|
# These packages are not supposed to be merged directly, instead
|
|
# please use sys-devel/crossdev to install them.
|
|
dev-util/mingw64-runtime
|
|
sys-libs/newlib
|
|
dev-embedded/avr-libc
|
|
sys-devel/nvptx-tools
|
|
sys-devel/clang-crossdev-wrappers
|